CAS 1060804-89-8

1-(4-Methyl-2-pyridinyl)cyclopropanecarboxylic acid

Description:

1-(4-Methyl-2-pyridinyl)cyclopropanecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a pyridine moiety. The presence of the 4-methyl group on the pyridine ring contributes to its lipophilicity and potential biological activity. This compound typically exhibits acidic properties due to the carboxylic acid functional group, which can participate in hydrogen bonding and influence its solubility in various solvents. The cyclopropane ring introduces strain, which can affect the compound's reactivity and stability. Additionally, the pyridine nitrogen may engage in coordination with metal ions, making it of interest in coordination chemistry. The compound's molecular interactions and potential applications could be explored in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Overall, its structural features suggest a versatile compound with potential implications in various chemical and biological contexts.

Formula: C₁₀H₁₁NO₂

InChI: InChI=1S/C10H11NO2/c1-7-2-5-11-8(6-7)10(3-4-10)9(12)13/h2,5-6H,3-4H2,1H3,(H,12,13)

InChI key: InChIKey=OGYQISBUFLFPLW-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(CC1)C2=CC(C)=CC=N2

Synonyms:

• 1-(4-Methyl-2-pyridinyl)cyclopropanecarboxylic acid
• Cyclopropanecarboxylic acid, 1-(4-methyl-2-pyridinyl)-