CAS 1060804-96-7

2,2,2-Trifluoro-1-(4-methyl-3-pyridinyl)ethanone

Description:

2,2,2-Trifluoro-1-(4-methyl-3-pyridinyl)ethanone, with the CAS number 1060804-96-7, is a chemical compound characterized by its unique trifluoroacetyl group and a pyridine ring. This compound features a trifluoromethyl group, which significantly enhances its lipophilicity and reactivity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The presence of the 4-methyl-3-pyridinyl moiety contributes to its potential biological activity, as pyridine derivatives are often associated with diverse pharmacological properties. The compound is typically a colorless to pale yellow liquid or solid, depending on the specific conditions, and exhibits moderate stability under standard conditions. Its molecular structure suggests it may participate in nucleophilic substitution reactions due to the electrophilic nature of the carbonyl group. Safety data indicates that, like many fluorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 2,2,2-Trifluoro-1-(4-methyl-3-pyridinyl)ethanone is a compound of interest in synthetic chemistry and medicinal research.

Formula: C₈H₆F₃NO

InChI: InChI=1S/C8H6F3NO/c1-5-2-3-12-4-6(5)7(13)8(9,10)11/h2-4H,1H3

InChI key: InChIKey=OGARYPOUBAKSSQ-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(=O)C=1C(C)=CC=NC1

Synonyms:

• Ethanone, 2,2,2-trifluoro-1-(4-methyl-3-pyridinyl)-
• 2,2,2-Trifluoro-1-(4-methyl-3-pyridinyl)ethanone