CymitQuimica logo

CAS 1060804-97-8

:

2,2,2-Trifluoro-1-(4-methyl-2-pyridinyl)ethanone

Description:
2,2,2-Trifluoro-1-(4-methyl-2-pyridinyl)ethanone, with the CAS number 1060804-97-8, is an organic compound characterized by its trifluoroacetyl group and a pyridine ring substituted with a methyl group. This compound features a carbonyl functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of three fluorine atoms enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The pyridine moiety can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, the compound's structure suggests potential uses in agrochemicals or pharmaceuticals, particularly in the development of novel therapeutic agents. Its physical properties, such as boiling point, melting point, and solubility, would typically be influenced by the fluorinated groups and the aromatic nature of the pyridine ring. Overall, 2,2,2-Trifluoro-1-(4-methyl-2-pyridinyl)ethanone is a versatile compound with significant implications in chemical research and application.
Formula:C8H6F3NO
InChI:InChI=1S/C8H6F3NO/c1-5-2-3-12-6(4-5)7(13)8(9,10)11/h2-4H,1H3
InChI key:InChIKey=GVQDMLUABICORA-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(=O)C1=CC(C)=CC=N1
Synonyms:
  • Ethanone, 2,2,2-trifluoro-1-(4-methyl-2-pyridinyl)-
  • 2,2,2-Trifluoro-1-(4-methyl-2-pyridinyl)ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.