CAS 1060805-01-7

α,4-Dimethyl-3-pyridinemethanamine

Description:

α,4-Dimethyl-3-pyridinemethanamine, identified by its CAS number 1060805-01-7, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features two methyl groups attached to the alpha and four positions of the pyridine ring, contributing to its unique chemical properties. It is classified as an amine due to the presence of an amino group (-NH2) attached to a methylene bridge (-CH2-) that connects to the pyridine ring. The presence of these functional groups suggests that α,4-Dimethyl-3-pyridinemethanamine may exhibit basic properties, typical of amines, and could participate in various chemical reactions, including alkylation and acylation. Its structural characteristics may also influence its solubility, reactivity, and potential applications in pharmaceuticals or as a building block in organic synthesis. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₈H₁₂N₂

InChI: InChI=1S/C8H12N2/c1-6-3-4-10-5-8(6)7(2)9/h3-5,7H,9H2,1-2H3

InChI key: InChIKey=IZVNSBQUTJTRTM-UHFFFAOYSA-N

SMILES: C(C)(N)C=1C(C)=CC=NC1

Synonyms:

• 3-Pyridinemethanamine, α,4-dimethyl-
• α,4-Dimethyl-3-pyridinemethanamine