CAS 1060805-02-8

4-Methyl-3-pyridinepropanamine

Description:

4-Methyl-3-pyridinepropanamine, identified by its CAS number 1060805-02-8, is an organic compound characterized by its pyridine ring and an amine functional group. This substance features a propanamine backbone with a methyl group attached to the pyridine ring, which influences its chemical properties and reactivity. Typically, compounds of this nature exhibit moderate polarity due to the presence of the amine group, allowing for potential hydrogen bonding interactions. The pyridine moiety contributes to the compound's aromatic character, which can affect its stability and solubility in various solvents. Additionally, the presence of the methyl group can enhance lipophilicity, potentially impacting biological activity and interactions with other molecules. As with many amines, 4-Methyl-3-pyridinepropanamine may exhibit basic properties, making it a candidate for various chemical reactions, including alkylation and acylation. Its specific applications and behavior in biological systems would depend on further studies, particularly in pharmacology or material science contexts.

Formula: C₉H₁₄N₂

InChI: InChI=1S/C9H14N2/c1-8-4-6-11-7-9(8)3-2-5-10/h4,6-7H,2-3,5,10H2,1H3

InChI key: InChIKey=PKTUUZGUHNUYIU-UHFFFAOYSA-N

SMILES: C(CCN)C=1C(C)=CC=NC1

Synonyms:

• 4-Methyl-3-pyridinepropanamine
• 3-Pyridinepropanamine, 4-methyl-