CymitQuimica logo

CAS 1060805-13-1

:

6-Bromo-4-methoxy-2-pyridinecarboxylic acid

Description:
6-Bromo-4-methoxy-2-pyridinecarboxylic acid is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a bromine atom at the 6-position and a methoxy group (-OCH3) at the 4-position of the pyridine ring, along with a carboxylic acid functional group (-COOH) at the 2-position. The presence of these functional groups contributes to its potential reactivity and solubility in various solvents. The bromine substituent can enhance the compound's electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. The methoxy group can influence the compound's electronic properties and steric hindrance, affecting its interactions with biological targets. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological systems. As with many organic compounds, its physical properties, such as melting point and solubility, would depend on the specific conditions and purity of the sample.
Formula:C7H6BrNO3
InChI:InChI=1S/C7H6BrNO3/c1-12-4-2-5(7(10)11)9-6(8)3-4/h2-3H,1H3,(H,10,11)
InChI key:InChIKey=UCVPDRVYDNGOIX-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(OC)=CC(Br)=N1
Synonyms:
  • 6-Bromo-4-methoxy-2-pyridinecarboxylic acid
  • 6-Bromo-4-methoxypyridine-2-carboxylic acid
  • 2-Pyridinecarboxylic acid, 6-bromo-4-methoxy-
Found 4 products.