
CAS 1060805-18-6
:6-Amino-4-methoxy-3-pyridinecarboxylic acid
Description:
6-Amino-4-methoxy-3-pyridinecarboxylic acid, identified by its CAS number 1060805-18-6, is an organic compound featuring a pyridine ring substituted with an amino group, a methoxy group, and a carboxylic acid functional group. This compound is characterized by its ability to participate in various chemical reactions due to the presence of both the amino and carboxylic acid functionalities, which can act as a base and an acid, respectively. The methoxy group contributes to the compound's overall polarity and can influence its solubility in different solvents. Additionally, the pyridine ring provides aromatic stability and can engage in π-π interactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research and development. Its structural features suggest potential applications in medicinal chemistry, particularly in the design of compounds targeting specific biological pathways. As with many organic compounds, its properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the substance.
Formula:C7H8N2O3
InChI:InChI=1S/C7H8N2O3/c1-12-5-2-6(8)9-3-4(5)7(10)11/h2-3H,1H3,(H2,8,9)(H,10,11)
InChI key:InChIKey=RXUFXKFABBDCRU-UHFFFAOYSA-N
SMILES:O(C)C=1C(C(O)=O)=CN=C(N)C1
Synonyms:- 3-Pyridinecarboxylic acid, 6-amino-4-methoxy-
- 6-Amino-4-methoxy-3-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.