CAS 1060805-25-5

1-(4-Methoxy-3-pyridinyl)cyclopropanamine

Description:

1-(4-Methoxy-3-pyridinyl)cyclopropanamine is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a pyridine moiety substituted with a methoxy group. The presence of the methoxy group enhances its solubility and may influence its biological activity. This compound is of interest in medicinal chemistry, particularly for its potential pharmacological properties. It may interact with various biological targets due to the presence of the nitrogen atom in the cyclopropanamine structure and the aromatic pyridine ring, which can participate in π-π stacking and hydrogen bonding interactions. The compound's molecular weight, melting point, and solubility characteristics are essential for understanding its behavior in biological systems and its potential applications in drug development. Additionally, the specific stereochemistry of the cyclopropane can affect its reactivity and interaction with biological targets, making it a subject of interest for further research in the fields of organic and medicinal chemistry.

Formula: C₉H₁₂N₂O

InChI: InChI=1S/C9H12N2O/c1-12-8-2-5-11-6-7(8)9(10)3-4-9/h2,5-6H,3-4,10H2,1H3

InChI key: InChIKey=VQVWVURCDBQGIS-UHFFFAOYSA-N

SMILES: NC1(C=2C(OC)=CC=NC2)CC1

Synonyms:

• Cyclopropanamine, 1-(4-methoxy-3-pyridinyl)-
• 1-(4-Methoxy-3-pyridinyl)cyclopropanamine