CAS 1060805-26-6
:1-(4-Methoxy-2-pyridinyl)cyclopropanemethanamine
Description:
1-(4-Methoxy-2-pyridinyl)cyclopropanemethanamine, identified by its CAS number 1060805-26-6, is a chemical compound characterized by its unique structural features, which include a cyclopropane ring and a pyridine moiety. The presence of the methoxy group on the pyridine ring enhances its solubility and may influence its biological activity. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, which may include interactions with neurotransmitter systems. Its molecular structure suggests it could act as a ligand for various receptors, potentially impacting neurological pathways. Additionally, the cyclopropane component may contribute to its conformational rigidity, affecting its reactivity and binding affinity. As with many organic compounds, its stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, 1-(4-Methoxy-2-pyridinyl)cyclopropanemethanamine represents a class of compounds that may have significant implications in drug development and therapeutic applications.
Formula:C10H14N2O
InChI:InChI=1S/C10H14N2O/c1-13-8-2-5-12-9(6-8)10(7-11)3-4-10/h2,5-6H,3-4,7,11H2,1H3
InChI key:InChIKey=BLEKODWCEMGUFK-UHFFFAOYSA-N
SMILES:C(N)C1(CC1)C2=CC(OC)=CC=N2
Synonyms:- Cyclopropanemethanamine, 1-(4-methoxy-2-pyridinyl)-
- 1-(4-Methoxy-2-pyridinyl)cyclopropanemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.