CymitQuimica logo

CAS 1060805-41-5

:

4-Methoxy-2-pyridinepropanamine

Description:
4-Methoxy-2-pyridinepropanamine is an organic compound characterized by its pyridine ring and a propanamine side chain. The presence of a methoxy group (-OCH3) at the 4-position of the pyridine ring contributes to its chemical properties, influencing its reactivity and solubility. This compound typically exhibits moderate polarity due to the combination of the polar amine group and the methoxy substituent, which can enhance its solubility in polar solvents. The amine functional group allows for hydrogen bonding, which can affect its interaction with biological systems, potentially making it of interest in medicinal chemistry. Additionally, the pyridine moiety may impart basic characteristics, enabling it to act as a ligand in coordination chemistry. The compound's structure suggests potential applications in pharmaceuticals or as a building block in organic synthesis. However, specific biological activity, toxicity, and environmental impact would require further investigation through empirical studies.
Formula:C9H14N2O
InChI:InChI=1S/C9H14N2O/c1-12-9-4-6-11-8(7-9)3-2-5-10/h4,6-7H,2-3,5,10H2,1H3
InChI key:InChIKey=LCGDTCDIGSIGER-UHFFFAOYSA-N
SMILES:C(CCN)C1=CC(OC)=CC=N1
Synonyms:
  • 2-Pyridinepropanamine, 4-methoxy-
  • 4-Methoxy-2-pyridinepropanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.