CymitQuimica logo

CAS 1060805-50-6

:

6-Bromo-4-(trifluoromethyl)-3-pyridinecarboxylic acid

Description:
6-Bromo-4-(trifluoromethyl)-3-pyridinecarboxylic acid is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 6-position and a trifluoromethyl group at the 4-position significantly influences its chemical properties, including its reactivity and polarity. This compound is typically a solid at room temperature and is soluble in polar organic solvents. It exhibits acidic properties due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, such as esterification and amidation. The trifluoromethyl group enhances the compound's lipophilicity and can affect its biological activity, making it of interest in medicinal chemistry and agrochemical applications. Additionally, the presence of halogens can influence the compound's stability and reactivity, making it a valuable intermediate in synthetic organic chemistry. Overall, 6-Bromo-4-(trifluoromethyl)-3-pyridinecarboxylic acid is a versatile compound with potential applications in various fields.
Formula:C7H3BrF3NO2
InChI:InChI=1S/C7H3BrF3NO2/c8-5-1-4(7(9,10)11)3(2-12-5)6(13)14/h1-2H,(H,13,14)
InChI key:InChIKey=WKWWCRMZDROUDM-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C(C(O)=O)=CN=C(Br)C1
Synonyms:
  • 6-Bromo-4-(trifluoromethyl)-3-pyridinecarboxylic acid
  • 3-Pyridinecarboxylic acid, 6-bromo-4-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.