CAS 1060805-58-4

1-[4-(Trifluoromethyl)-2-pyridinyl]cyclopropanecarboxylic acid

Description:

1-[4-(Trifluoromethyl)-2-pyridinyl]cyclopropanecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a pyridine moiety substituted with a trifluoromethyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The trifluoromethyl group is known for imparting lipophilicity and enhancing metabolic stability, making the compound of interest in medicinal chemistry and agrochemical applications. The presence of the carboxylic acid functional group suggests acidic properties, allowing for potential interactions in biological systems, such as hydrogen bonding and ionic interactions. Additionally, the compound may exhibit interesting pharmacological activities due to its structural features, which can influence its binding affinity to biological targets. Overall, the unique combination of functional groups and structural elements makes this compound a subject of interest for further research in various chemical and biological contexts.

Formula: C₁₀H₈F₃NO₂

InChI: InChI=1S/C10H8F3NO2/c11-10(12,13)6-1-4-14-7(5-6)9(2-3-9)8(15)16/h1,4-5H,2-3H2,(H,15,16)

InChI key: InChIKey=VDBOSOKZPOFASX-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(CC1)C2=CC(C(F)(F)F)=CC=N2

Synonyms:

• Cyclopropanecarboxylic acid, 1-[4-(trifluoromethyl)-2-pyridinyl]-
• 1-[4-(Trifluoromethyl)-2-pyridinyl]cyclopropanecarboxylic acid