CAS 1060805-63-1

4-Bromo-3-pyridinemethanamine

Description:

4-Bromo-3-pyridinemethanamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 4-position and an amine group at the 3-position of the pyridine ring contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar solvents due to the amine functionality, which can engage in hydrogen bonding. It may exhibit basic properties due to the amine group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The bromine substituent can also serve as a site for further functionalization, making it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 4-Bromo-3-pyridinemethanamine is a versatile compound with applications in medicinal chemistry and material science.

Formula: C₆H₇BrN₂

InChI: InChI=1S/C6H7BrN2/c7-6-1-2-9-4-5(6)3-8/h1-2,4H,3,8H2

InChI key: InChIKey=BCSXLCYWDRHBGE-UHFFFAOYSA-N

SMILES: C(N)C=1C(Br)=CC=NC1

Synonyms:

• 3-Pyridinemethanamine, 4-bromo-
• (4-Bromopyridin-3-yl)methanamine
• 4-Bromo-3-pyridinemethanamine