CAS 1060805-64-2

4-Bromo-6-chloronicotinaldehyde

Description:

4-Bromo-6-chloronicotinaldehyde is an organic compound that belongs to the class of heterocyclic aromatic compounds, specifically a substituted pyridine derivative. It features a pyridine ring with both a bromine and a chlorine substituent, as well as an aldehyde functional group. This compound is characterized by its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the aldehyde group which can participate in various chemical reactions, such as condensation and nucleophilic addition. The halogen substituents (bromine and chlorine) can influence the compound's reactivity, solubility, and biological activity. Additionally, the presence of these halogens may enhance the compound's lipophilicity, making it more suitable for interactions with biological targets. As with many halogenated compounds, considerations regarding environmental impact and toxicity are important, necessitating careful handling and assessment in research and industrial applications. Overall, 4-Bromo-6-chloronicotinaldehyde represents a versatile building block in organic synthesis and drug discovery.

Formula: C₆H₃BrClNO

InChI: InChI=1S/C6H3BrClNO/c7-5-1-6(8)9-2-4(5)3-10/h1-3H

SMILES: c1c(c(cnc1Cl)C=O)Br

4-Bromo-6-chloronicotinaldehyde

CAS: 1060805-64-2

Formula: C₆H₃BrClNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 220.4511

Ref: IN-DA008YEQ

4-Bromo-6-chloropyridine-3-carbaldehyde

CAS: 1060805-64-2

4-Bromo-6-chloropyridine-3-carbaldehyde

Purity: 98%

Molecular weight: 220.45g/mol

Ref: 54-OR72954

4-BROMO-6-CHLORONICOTINALDEHYDE

CAS: 1060805-64-2

Formula: C₆H₃BrClNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 220.45

Ref: 10-F306798