CymitQuimica logo

CAS 1060805-96-0

:

4-Bromo-6-methyl-3-pyridinecarboxylic acid

Description:
4-Bromo-6-methyl-3-pyridinecarboxylic acid is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 4-position and a methyl group at the 6-position contributes to its unique chemical properties. This compound features a carboxylic acid functional group at the 3-position, which imparts acidic characteristics and enhances its reactivity in various chemical reactions. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The compound can participate in various chemical transformations, including esterification and amidation, making it useful in synthetic organic chemistry. Additionally, its bromine substituent can facilitate further functionalization through nucleophilic substitution reactions. Overall, 4-Bromo-6-methyl-3-pyridinecarboxylic acid is a versatile building block in the synthesis of pharmaceuticals and agrochemicals.
Formula:C7H6BrNO2
InChI:InChI=1S/C7H6BrNO2/c1-4-2-6(8)5(3-9-4)7(10)11/h2-3H,1H3,(H,10,11)
InChI key:InChIKey=FYWMYYUNSJWYKV-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(Br)=CC(C)=NC1
Synonyms:
  • 3-Pyridinecarboxylic acid, 4-bromo-6-methyl-
  • 4-Bromo-6-methyl-3-pyridinecarboxylic acid
  • 4-Bromo-6-methylpyridine-3-carboxylic acid
  • 4-BroMo-6-Methylnicotinic acid
Found 4 products.