CAS 1060805-98-2

4-Bromo-2-methyl-3-pyridinecarboxylic acid

Description:

4-Bromo-2-methyl-3-pyridinecarboxylic acid is an organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a bromine substituent at the 4-position and a methyl group at the 2-position of the pyridine ring, along with a carboxylic acid functional group at the 3-position. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The carboxylic acid group imparts acidic properties, allowing for hydrogen bonding and solubility in polar solvents. The bromine atom can participate in electrophilic substitution reactions, making the compound versatile for further chemical modifications. Additionally, the methyl group can influence the compound's steric and electronic properties. Overall, 4-Bromo-2-methyl-3-pyridinecarboxylic acid is a valuable compound in synthetic organic chemistry, with potential uses in the development of biologically active molecules.

Formula: C₇H₆BrNO₂

InChI: InChI=1S/C7H6BrNO2/c1-4-6(7(10)11)5(8)2-3-9-4/h2-3H,1H3,(H,10,11)

InChI key: InChIKey=OGYWFIXRYKZWKV-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(Br)=CC=NC1C

Synonyms:

• 4-Bromo-2-methyl-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 4-bromo-2-methyl-

4-Bromo-2-methylnicotinic acid

CAS: 1060805-98-2

Formula: C₇H₆BrNO₂

Molecular weight: 216.0320

Ref: IN-DA007VWV