CAS 1060806-00-9

2-Fluoro-6-methyl-4-pyridinecarboxylic acid

Description:

2-Fluoro-6-methyl-4-pyridinecarboxylic acid is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 2-position with a fluorine atom, at the 6-position with a methyl group, and at the 4-position with a carboxylic acid functional group. This compound exhibits properties typical of pyridine derivatives, including potential acidity due to the carboxylic acid group, and it may participate in hydrogen bonding due to the presence of the carboxylic acid. The fluorine substitution can influence the compound's reactivity and polarity, potentially enhancing its solubility in polar solvents. Additionally, the presence of the methyl group can affect steric hindrance and electronic properties, which may be relevant in various chemical reactions or applications. This compound may be of interest in pharmaceutical research or as an intermediate in organic synthesis, given the functional groups present that can facilitate further chemical transformations. Its specific applications and behavior would depend on the context of its use in research or industry.

Formula: C₇H₆FNO₂

InChI: InChI=1S/C7H6FNO2/c1-4-2-5(7(10)11)3-6(8)9-4/h2-3H,1H3,(H,10,11)

InChI key: InChIKey=IEGMXPAJVPBGGN-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(C)N=C(F)C1

Synonyms:

• 2-Fluoro-6-methyl-4-pyridinecarboxylic acid
• 4-Pyridinecarboxylic acid, 2-fluoro-6-methyl-