CAS 1060806-06-5

4-Amino-2-methyl-3-pyridinecarboxylic acid

Description:

4-Amino-2-methyl-3-pyridinecarboxylic acid, also known as a derivative of pyridine, is characterized by the presence of an amino group and a carboxylic acid functional group attached to a pyridine ring. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to its functional groups. The amino group can participate in hydrogen bonding, enhancing its reactivity and interaction with other molecules. The methyl group contributes to the compound's hydrophobic character, influencing its overall solubility and stability. This substance may have applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis, owing to its functional versatility. Additionally, its structure suggests potential biological activity, which could be explored in medicinal chemistry. As with many pyridine derivatives, it may exhibit unique electronic properties due to the aromatic nature of the pyridine ring, affecting its reactivity and interaction with other chemical species.

Formula: C₇H₈N₂O₂

InChI: InChI=1S/C7H8N2O2/c1-4-6(7(10)11)5(8)2-3-9-4/h2-3H,1H3,(H2,8,9)(H,10,11)

InChI key: InChIKey=XMCUVSNLCJOLFB-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(N)=CC=NC1C

Synonyms:

• 3-Pyridinecarboxylic acid, 4-amino-2-methyl-
• 4-Amino-2-methyl-3-pyridinecarboxylic acid