
CAS 1060806-09-8
:1-(6-Methyl-2-pyridinyl)cyclopropanamine
Description:
1-(6-Methyl-2-pyridinyl)cyclopropanamine is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a pyridine moiety. The presence of the 6-methyl group on the pyridine ring contributes to its lipophilicity and potential biological activity. This compound is classified as an amine due to the presence of the amine functional group (-NH2), which can participate in hydrogen bonding and influence its reactivity and solubility in various solvents. The cyclopropane ring introduces strain, which can affect the compound's stability and reactivity. Additionally, the compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its specific interactions with biological targets would depend on the overall three-dimensional conformation and electronic properties imparted by the substituents. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C9H12N2
InChI:InChI=1S/C9H12N2/c1-7-3-2-4-8(11-7)9(10)5-6-9/h2-4H,5-6,10H2,1H3
InChI key:InChIKey=BKGIWFFWGSVVPS-UHFFFAOYSA-N
SMILES:NC1(CC1)C=2N=C(C)C=CC2
Synonyms:- 1-(6-Methylpyridin-2-yl)cyclopropan-1-amine
- Cyclopropanamine, 1-(6-methyl-2-pyridinyl)-
- 1-(6-Methyl-2-pyridinyl)cyclopropanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.