
CAS 1060806-11-2
:1-(2-Methyl-4-pyridinyl)cyclopropanamine
Description:
1-(2-Methyl-4-pyridinyl)cyclopropanamine is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a pyridine moiety. The presence of the 2-methyl-4-pyridinyl group suggests that it may exhibit specific biological activities, potentially influencing its interaction with various receptors or enzymes. This compound is likely to be a solid at room temperature, given the typical properties of similar organic compounds. Its molecular structure indicates the potential for hydrogen bonding due to the amine functional group, which can affect its solubility in polar solvents. Additionally, the presence of the pyridine ring may contribute to its aromatic character, influencing its stability and reactivity. The compound's CAS number, 1060806-11-2, allows for precise identification in chemical databases, facilitating research and application in fields such as medicinal chemistry or pharmacology. Overall, 1-(2-Methyl-4-pyridinyl)cyclopropanamine presents interesting characteristics that warrant further investigation for potential therapeutic uses.
Formula:C9H12N2
InChI:InChI=1S/C9H12N2/c1-7-6-8(2-5-11-7)9(10)3-4-9/h2,5-6H,3-4,10H2,1H3
InChI key:InChIKey=QUMPJJYNWWTRDG-UHFFFAOYSA-N
SMILES:NC1(CC1)C=2C=C(C)N=CC2
Synonyms:- 1-(2-Methyl-4-pyridinyl)cyclopropanamine
- Cyclopropanamine, 1-(2-methyl-4-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.