CAS 1060806-13-4
:1-(6-Methyl-2-pyridinyl)cyclopropanecarboxylic acid
Description:
1-(6-Methyl-2-pyridinyl)cyclopropanecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a pyridine moiety. The presence of the methyl group on the pyridine ring contributes to its lipophilicity, potentially influencing its biological activity and solubility. This compound is likely to exhibit acidic properties due to the carboxylic acid functional group, which can donate protons in solution. The cyclopropane ring introduces strain, which can affect the reactivity and stability of the molecule. Additionally, the pyridine nitrogen may participate in hydrogen bonding or coordination with metal ions, enhancing its potential applications in medicinal chemistry or as a ligand in coordination chemistry. Overall, the combination of these structural features suggests that 1-(6-Methyl-2-pyridinyl)cyclopropanecarboxylic acid could have interesting pharmacological properties, although specific biological activities would need to be investigated through experimental studies.
Formula:C10H11NO2
InChI:InChI=1S/C10H11NO2/c1-7-3-2-4-8(11-7)10(5-6-10)9(12)13/h2-4H,5-6H2,1H3,(H,12,13)
InChI key:InChIKey=URIQHKLFYYBLEP-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(CC1)C=2N=C(C)C=CC2
Synonyms:- 1-(6-Methyl-2-pyridinyl)cyclopropanecarboxylic acid
- Cyclopropanecarboxylic acid, 1-(6-methyl-2-pyridinyl)-
- 1-(6-Methylpyridin-2-yl)cyclopropane-1-carboxylic acid
- 1-(6-methylpyridin-2-yl)cyclopropanecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
