CAS 1060806-13-4: 1-(6-Methyl-2-pyridinyl)cyclopropanecarboxylic acid
Description:1-(6-Methyl-2-pyridinyl)cyclopropanecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a pyridine moiety. The presence of the methyl group on the pyridine ring contributes to its lipophilicity, potentially influencing its biological activity and solubility. This compound is likely to exhibit acidic properties due to the carboxylic acid functional group, which can donate protons in solution. The cyclopropane ring introduces strain, which can affect the reactivity and stability of the molecule. Additionally, the pyridine nitrogen may participate in hydrogen bonding or coordination with metal ions, enhancing its potential applications in medicinal chemistry or as a ligand in coordination chemistry. Overall, the combination of these structural features suggests that 1-(6-Methyl-2-pyridinyl)cyclopropanecarboxylic acid could have interesting pharmacological properties, although specific biological activities would need to be investigated through experimental studies.
Formula:C10H11NO2
InChI:InChI=1S/C10H11NO2/c1-7-3-2-4-8(11-7)10(5-6-10)9(12)13/h2-4H,5-6H2,1H3,(H,12,13)
InChI key:InChIKey=URIQHKLFYYBLEP-UHFFFAOYSA-N
SMILES:O=C(O)C1(C2=NC(=CC=C2)C)CC1
- Synonyms:
- 1-(6-Methyl-2-pyridinyl)cyclopropanecarboxylic acid
- Cyclopropanecarboxylic acid, 1-(6-methyl-2-pyridinyl)-
- 1-(6-Methylpyridin-2-yl)cyclopropane-1-carboxylic acid
- 1-(6-methylpyridin-2-yl)cyclopropanecarboxylic acid
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1-(6-Methylpyridin-2-yl)cyclopropanecarboxylic acid REF: IN-DA0097HMCAS: 1060806-13-4 | - - - | To inquire | Tue 12 Aug 25 |
![]() | 1-(6-Methylpyridin-2-yl)cyclopropanecarboxylic acid REF: 3D-KSB80613CAS: 1060806-13-4 | Min. 95% | - - - | Discontinued product |

1-(6-Methylpyridin-2-yl)cyclopropanecarboxylic acid
Ref: IN-DA0097HM
Undefined size | To inquire |

1-(6-Methylpyridin-2-yl)cyclopropanecarboxylic acid
Ref: 3D-KSB80613
5mg | Discontinued | Request information | |
50mg | Discontinued | Request information |