CymitQuimica logo

CAS 1060806-15-6

:

1-(2-Methyl-4-pyridinyl)cyclopropanecarboxylic acid

Description:
1-(2-Methyl-4-pyridinyl)cyclopropanecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a pyridine moiety. The presence of the 2-methyl-4-pyridinyl group contributes to its potential biological activity, as pyridine derivatives are often associated with various pharmacological properties. This compound is likely to exhibit acidic behavior due to the carboxylic acid functional group, which can donate protons in solution. Its molecular structure suggests that it may have interesting steric and electronic properties, influencing its reactivity and interactions with other molecules. The cyclopropane ring introduces strain, which can enhance reactivity compared to more stable cyclic structures. Additionally, the compound may be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, making it a subject of interest for further research in both synthetic and applied chemistry contexts.
Formula:C10H11NO2
InChI:InChI=1S/C10H11NO2/c1-7-6-8(2-5-11-7)10(3-4-10)9(12)13/h2,5-6H,3-4H2,1H3,(H,12,13)
InChI key:InChIKey=SUTDMQTZKILBJU-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(CC1)C=2C=C(C)N=CC2
Synonyms:
  • Cyclopropanecarboxylic acid, 1-(2-methyl-4-pyridinyl)-
  • 1-(2-Methyl-4-pyridinyl)cyclopropanecarboxylic acid
  • 1-(2-Methylpyridin-4-yl)cyclopropane-1-carboxylic acid
  • 1-(2-Methylpyridin-4-yl)cyclopropanecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.