CAS 1060806-23-6

1-(2-Methyl-4-pyridinyl)cyclopropanemethanamine

Description:

1-(2-Methyl-4-pyridinyl)cyclopropanemethanamine, identified by its CAS number 1060806-23-6, is a chemical compound characterized by its unique structural features, which include a cyclopropane ring and a pyridine moiety. The presence of the 2-methyl-4-pyridinyl group suggests that the compound may exhibit basic properties due to the nitrogen atom in the pyridine ring, which can participate in protonation. This compound is likely to be a solid at room temperature, given the typical characteristics of similar organic compounds. Its molecular structure may impart specific biological activities, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The cyclopropane component can contribute to the rigidity of the molecule, potentially influencing its interaction with biological targets. Additionally, the presence of functional groups may affect its solubility, stability, and reactivity, which are important factors in its application in various chemical and biological contexts. Further studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₁₀H₁₄N₂

InChI: InChI=1S/C10H14N2/c1-8-6-9(2-5-12-8)10(7-11)3-4-10/h2,5-6H,3-4,7,11H2,1H3

InChI key: InChIKey=ITAPTTDXOPDEJO-UHFFFAOYSA-N

SMILES: C(N)C1(CC1)C=2C=C(C)N=CC2

Synonyms:

• (1-(2-Methylpyridin-4-yl)cyclopropyl)methanamine
• 1-(2-Methyl-4-pyridinyl)cyclopropanemethanamine
• Cyclopropanemethanamine, 1-(2-methyl-4-pyridinyl)-