CAS 1060806-24-7

1-(2-Methyl-3-pyridinyl)cyclopropanemethanamine

Description:

1-(2-Methyl-3-pyridinyl)cyclopropanemethanamine, identified by its CAS number 1060806-24-7, is a chemical compound characterized by its unique structural features, which include a cyclopropane ring and a pyridine moiety. The presence of the 2-methyl-3-pyridinyl group suggests that it may exhibit specific biological activities, potentially influencing its interaction with various receptors or enzymes. This compound is likely to be a solid at room temperature, given the stability of its cyclopropane structure. Its molecular structure may impart certain polar characteristics, affecting its solubility in different solvents. Additionally, the amine functional group indicates that it can participate in hydrogen bonding, which may influence its reactivity and interactions in biological systems. The compound's potential applications could span medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyridine ring, which is often associated with bioactive compounds. Further studies would be necessary to elucidate its specific properties, reactivity, and potential therapeutic uses.

Formula: C₁₀H₁₄N₂

InChI: InChI=1S/C10H14N2/c1-8-9(3-2-6-12-8)10(7-11)4-5-10/h2-3,6H,4-5,7,11H2,1H3

InChI key: InChIKey=AZCUEMOZWQYSGJ-UHFFFAOYSA-N

SMILES: C(N)C1(CC1)C2=C(C)N=CC=C2

Synonyms:

• Cyclopropanemethanamine, 1-(2-methyl-3-pyridinyl)-
• 1-(2-Methyl-3-pyridinyl)cyclopropanemethanamine