
CAS 1060806-28-1
:2,2,2-Trifluoro-1-(2-methyl-4-pyridinyl)ethanone
Description:
2,2,2-Trifluoro-1-(2-methyl-4-pyridinyl)ethanone, with the CAS number 1060806-28-1, is a chemical compound characterized by its unique structure that includes a trifluoroacetyl group and a pyridine ring. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It exhibits significant polarity due to the presence of the trifluoromethyl group, which enhances its reactivity and solubility in polar solvents. The pyridine moiety contributes to its potential biological activity, making it of interest in medicinal chemistry. The trifluoromethyl group is known to influence the compound's electronic properties, potentially affecting its interactions with biological targets. Additionally, this compound may exhibit stability under various conditions, but it is essential to handle it with care due to the presence of fluorine, which can impart toxicity and environmental concerns. Overall, 2,2,2-Trifluoro-1-(2-methyl-4-pyridinyl)ethanone is a compound of interest in both synthetic and pharmaceutical chemistry.
Formula:C8H6F3NO
InChI:InChI=1S/C8H6F3NO/c1-5-4-6(2-3-12-5)7(13)8(9,10)11/h2-4H,1H3
InChI key:InChIKey=MDROARTVKRPMCC-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(=O)C=1C=C(C)N=CC1
Synonyms:- 2,2,2-Trifluoro-1-(2-methyl-4-pyridinyl)ethanone
- Ethanone, 2,2,2-trifluoro-1-(2-methyl-4-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.