CAS 1060806-61-2

4-Bromo-6-methoxy-3-pyridinecarboxylic acid

Description:

4-Bromo-6-methoxy-3-pyridinecarboxylic acid is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 4-position and a methoxy group at the 6-position contributes to its unique chemical properties. This compound features a carboxylic acid functional group at the 3-position, which imparts acidic characteristics and enhances its solubility in polar solvents. The bromine substituent can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The methoxy group can also affect the electronic properties of the molecule, potentially enhancing its reactivity or stability. Due to these features, 4-Bromo-6-methoxy-3-pyridinecarboxylic acid may find applications in medicinal chemistry, agrochemicals, or as an intermediate in organic synthesis. Its specific interactions and behavior in biological systems or chemical reactions would depend on the context of its use and the presence of other functional groups or solvents.

Formula: C₇H₆BrNO₃

InChI: InChI=1S/C7H6BrNO3/c1-12-6-2-5(8)4(3-9-6)7(10)11/h2-3H,1H3,(H,10,11)

InChI key: InChIKey=APWCDGJEQKKPRC-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(Br)=CC(OC)=NC1

Synonyms:

• 4-Bromo-6-methoxy-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 4-bromo-6-methoxy-