CymitQuimica logo

CAS 1060806-62-3

:

6-Bromo-2-methoxy-3-pyridinecarboxylic acid

Description:
6-Bromo-2-methoxy-3-pyridinecarboxylic acid is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 6-position and a methoxy group at the 2-position contributes to its unique reactivity and properties. The carboxylic acid functional group at the 3-position enhances its acidity and solubility in polar solvents, making it useful in various chemical reactions and applications. This compound may exhibit biological activity, potentially serving as a precursor in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure allows for various functionalization possibilities, making it a valuable intermediate in organic synthesis. Additionally, the presence of both electron-withdrawing (bromine) and electron-donating (methoxy) groups can influence its electronic properties, affecting its reactivity and interaction with other molecules. Overall, 6-Bromo-2-methoxy-3-pyridinecarboxylic acid is a versatile compound with potential applications in medicinal chemistry and material science.
Formula:C7H6BrNO3
InChI:InChI=1S/C7H6BrNO3/c1-12-6-4(7(10)11)2-3-5(8)9-6/h2-3H,1H3,(H,10,11)
InChI key:InChIKey=YMPQUJFCCCPCAF-UHFFFAOYSA-N
SMILES:O(C)C1=C(C(O)=O)C=CC(Br)=N1
Synonyms:
  • 3-Pyridinecarboxylic acid, 6-bromo-2-methoxy-
  • 6-Bromo-2-methoxy-3-pyridinecarboxylic acid
  • 6-Bromo-2-methoxynicotinic acid
Found 5 products.