CAS 1060806-78-1

4-Amino-2-methoxy-3-pyridinecarboxylic acid

Description:

4-Amino-2-methoxy-3-pyridinecarboxylic acid, with the CAS number 1060806-78-1, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amino group (-NH2) and a methoxy group (-OCH3) attached to the pyridine ring, as well as a carboxylic acid group (-COOH) that contributes to its acidic properties. The presence of these functional groups suggests that it may exhibit both basic and acidic behavior, making it a potential candidate for various chemical reactions. It is likely to be soluble in polar solvents due to the presence of the carboxylic acid and amino groups, which can engage in hydrogen bonding. Additionally, the methoxy group may influence its electronic properties and reactivity. This compound may have applications in pharmaceuticals or as a building block in organic synthesis, although specific applications would depend on further research into its biological activity and chemical behavior.

Formula: C₇H₈N₂O₃

InChI: InChI=1S/C7H8N2O3/c1-12-6-5(7(10)11)4(8)2-3-9-6/h2-3H,1H3,(H2,8,9)(H,10,11)

InChI key: InChIKey=OHGVTMPEXNJZOK-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(OC)N=CC=C1N

Synonyms:

• 3-Pyridinecarboxylic acid, 4-amino-2-methoxy-
• 4-Amino-2-methoxy-3-pyridinecarboxylic acid