CAS 1060806-83-8

Methyl 1,6-dihydro-2-methoxy-6-oxo-3-pyridinecarboxylate

Description:

Methyl 1,6-dihydro-2-methoxy-6-oxo-3-pyridinecarboxylate, with the CAS number 1060806-83-8, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a methoxy group (-OCH3) and a carboxylate ester functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the keto group (C=O) at the 6-position of the pyridine ring indicates that it may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. Its dihydro form suggests that it has two hydrogen atoms added to the ring, which may influence its stability and reactivity. Methyl 1,6-dihydro-2-methoxy-6-oxo-3-pyridinecarboxylate may be of interest in medicinal chemistry and agrochemicals due to its structural features, which could lead to biological activity or serve as a precursor for further chemical modifications. As with any chemical substance, proper handling and safety measures should be observed.

Formula: C₈H₉NO₄

InChI: InChI=1S/C8H9NO4/c1-12-7-5(8(11)13-2)3-4-6(10)9-7/h3-4H,1-2H3,(H,9,10)

InChI key: InChIKey=PJYUHVWZBXPRKR-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(OC)NC(=O)C=C1

Synonyms:

• 3-Pyridinecarboxylic acid, 1,6-dihydro-2-methoxy-6-oxo-, methyl ester
• Methyl 1,6-dihydro-2-methoxy-6-oxo-3-pyridinecarboxylate