
CAS 1060807-00-2
:1-(2-Methoxy-3-pyridinyl)cyclopropanamine
Description:
1-(2-Methoxy-3-pyridinyl)cyclopropanamine is a chemical compound characterized by its unique structure, which includes a cyclopropane ring fused with a pyridine moiety substituted with a methoxy group. This compound typically exhibits properties associated with both amines and aromatic heterocycles, such as moderate polarity and potential for hydrogen bonding due to the presence of the amine functional group. The methoxy group enhances its solubility in organic solvents and may influence its biological activity. The pyridine ring contributes to the compound's aromaticity and can participate in various chemical reactions, including electrophilic substitution. Additionally, the cyclopropane structure introduces ring strain, which can affect the compound's reactivity and stability. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential interactions with biological targets. Overall, 1-(2-Methoxy-3-pyridinyl)cyclopropanamine is a versatile compound with interesting chemical and biological properties.
Formula:C9H12N2O
InChI:InChI=1S/C9H12N2O/c1-12-8-7(3-2-6-11-8)9(10)4-5-9/h2-3,6H,4-5,10H2,1H3
InChI key:InChIKey=GMORONPEXQVQLA-UHFFFAOYSA-N
SMILES:NC1(C2=C(OC)N=CC=C2)CC1
Synonyms:- Cyclopropanamine, 1-(2-methoxy-3-pyridinyl)-
- 1-(2-Methoxy-3-pyridinyl)cyclopropanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.