CymitQuimica logo

CAS 1060807-01-3

:

1-(6-Methoxy-2-pyridinyl)cyclopropanecarboxylic acid

Description:
1-(6-Methoxy-2-pyridinyl)cyclopropanecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a pyridine moiety. The presence of the methoxy group at the 6-position of the pyridine ring contributes to its potential biological activity, possibly influencing its solubility and reactivity. This compound is likely to exhibit acidic properties due to the carboxylic acid functional group, which can donate protons in solution. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound may also display specific stereochemical configurations due to the cyclopropane ring, which can affect its pharmacokinetic and pharmacodynamic profiles. Additionally, the presence of heteroatoms like nitrogen and oxygen in its structure may enhance its reactivity and ability to form hydrogen bonds, influencing its behavior in various chemical environments. Overall, this compound's unique features make it a subject of interest for further research in both synthetic and medicinal chemistry.
Formula:C10H11NO3
InChI:InChI=1S/C10H11NO3/c1-14-8-4-2-3-7(11-8)10(5-6-10)9(12)13/h2-4H,5-6H2,1H3,(H,12,13)
InChI key:InChIKey=QWOZINGRPSBARY-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(CC1)C=2N=C(OC)C=CC2
Synonyms:
  • Cyclopropanecarboxylic acid, 1-(6-methoxy-2-pyridinyl)-
  • 1-(6-Methoxy-2-pyridinyl)cyclopropanecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.