CAS 1060807-03-5
:1-(2-Methoxy-4-pyridinyl)cyclopropanecarboxylic acid
Description:
1-(2-Methoxy-4-pyridinyl)cyclopropanecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a pyridine moiety. The presence of the methoxy group on the pyridine ring enhances its solubility and reactivity. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in medicinal chemistry due to its structural features that may influence biological activity. The cyclopropane ring contributes to the compound's strain and reactivity, making it a point of interest in synthetic organic chemistry. Additionally, the carboxylic acid functional group provides acidic properties, allowing for potential interactions in various chemical environments. Its specific interactions and reactivity can be influenced by the electronic effects of the methoxy and pyridine groups, which may also play a role in its pharmacological profile. Overall, this compound represents a fascinating example of how structural elements can dictate chemical behavior and potential applications in drug development.
Formula:C10H11NO3
InChI:InChI=1S/C10H11NO3/c1-14-8-6-7(2-5-11-8)10(3-4-10)9(12)13/h2,5-6H,3-4H2,1H3,(H,12,13)
InChI key:InChIKey=HVWNYPQMLIJPKZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(CC1)C=2C=C(OC)N=CC2
Synonyms:- 1-(2-Methoxypyridin-4-yl)cyclopropane-1-carboxylic acid
- 1-(2-Methoxypyridin-4-yl)cyclopropanecarboxylic acid
- Cyclopropanecarboxylic acid, 1-(2-methoxy-4-pyridinyl)-
- 1-(2-Methoxy-4-pyridinyl)cyclopropanecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(2-Methoxy-pyridin-4-yl)-cyclopropanecarboxylic acid
CAS:Formula:C10H11NO3Molecular weight:193.1992
