CAS 1060807-05-7

1-(6-Methoxy-2-pyridinyl)cyclopropanemethanamine

Description:

1-(6-Methoxy-2-pyridinyl)cyclopropanemethanamine is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a pyridine moiety. The presence of the methoxy group at the 6-position of the pyridine ring contributes to its potential biological activity, possibly influencing its interaction with various receptors or enzymes. This compound may exhibit properties typical of amines, such as basicity, and could participate in hydrogen bonding due to the amine functional group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions. The compound's specific interactions and efficacy would depend on its conformation and the electronic effects imparted by the methoxy and pyridine groups. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.

Formula: C₁₀H₁₄N₂O

InChI: InChI=1S/C10H14N2O/c1-13-9-4-2-3-8(12-9)10(7-11)5-6-10/h2-4H,5-7,11H2,1H3

InChI key: InChIKey=TYXDKUPETPVOHV-UHFFFAOYSA-N

SMILES: C(N)C1(CC1)C=2N=C(OC)C=CC2

Synonyms:

• Cyclopropanemethanamine, 1-(6-methoxy-2-pyridinyl)-
• 1-(6-Methoxy-2-pyridinyl)cyclopropanemethanamine