CymitQuimica logo

CAS 1060807-24-0

:

2-Methoxy-α-(trifluoromethyl)-4-pyridinemethanamine

Description:
2-Methoxy-α-(trifluoromethyl)-4-pyridinemethanamine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a methoxy group (-OCH3) and a trifluoromethyl group (-CF3) significantly influences its chemical properties, including its reactivity and polarity. The trifluoromethyl group is known for imparting lipophilicity and enhancing metabolic stability, while the methoxy group can affect the compound's solubility and electronic properties. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structure suggests potential interactions with biological targets, possibly influencing enzyme activity or receptor binding. Additionally, the presence of the amino group (-NH2) indicates potential for further derivatization or interaction with other chemical entities. Overall, 2-Methoxy-α-(trifluoromethyl)-4-pyridinemethanamine is a complex molecule with unique characteristics that may be leveraged in various chemical and pharmaceutical applications.
Formula:C8H9F3N2O
InChI:InChI=1S/C8H9F3N2O/c1-14-6-4-5(2-3-13-6)7(12)8(9,10)11/h2-4,7H,12H2,1H3
InChI key:InChIKey=DTZHBOKZBJARPN-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(N)C=1C=C(OC)N=CC1
Synonyms:
  • 2-Methoxy-α-(trifluoromethyl)-4-pyridinemethanamine
  • 4-Pyridinemethanamine, 2-methoxy-α-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.