CAS 1060807-25-1

2-Methoxy-α-methyl-3-pyridinemethanamine

Description:

2-Methoxy-α-methyl-3-pyridinemethanamine, identified by its CAS number 1060807-25-1, is a chemical compound that features a pyridine ring substituted with a methoxy group and an α-methyl group. This structure contributes to its unique properties, including its potential as a pharmacological agent. The presence of the methoxy group enhances its lipophilicity, which can influence its bioavailability and interaction with biological systems. The compound may exhibit basic properties due to the amine functional group, allowing it to participate in protonation reactions. Additionally, the pyridine moiety can engage in various interactions, such as hydrogen bonding and π-π stacking, which are significant in biological contexts. Its synthesis typically involves the reaction of appropriate precursors under controlled conditions, and it may be of interest in medicinal chemistry for its potential therapeutic applications. As with many organic compounds, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other functional groups.

Formula: C₈H₁₂N₂O

InChI: InChI=1S/C8H12N2O/c1-6(9)7-4-3-5-10-8(7)11-2/h3-6H,9H2,1-2H3

InChI key: InChIKey=SVHGXPRQYCQZDW-UHFFFAOYSA-N

SMILES: O(C)C1=C(C(C)N)C=CC=N1

Synonyms:

• 2-Methoxy-α-methyl-3-pyridinemethanamine
• 3-Pyridinemethanamine, 2-methoxy-α-methyl-
• 1-(2-Methoxypyridin-3-yl)ethanamine