
CAS 1060807-67-1
:1,1-Dimethylethyl 2-(1H-indol-3-ylmethyl)-1-piperazinecarboxylate
Description:
1,1-Dimethylethyl 2-(1H-indol-3-ylmethyl)-1-piperazinecarboxylate, identified by its CAS number 1060807-67-1, is a chemical compound characterized by its complex structure, which includes an indole moiety and a piperazine ring. This compound typically exhibits properties associated with both the indole and piperazine functionalities, such as potential biological activity and solubility in organic solvents. The presence of the dimethyl group contributes to steric hindrance, which may influence its reactivity and interaction with biological targets. It is often studied in medicinal chemistry for its potential pharmacological applications, particularly in the development of new therapeutic agents. The compound's stability, reactivity, and interaction with other molecules can be influenced by factors such as pH, temperature, and the presence of other functional groups. As with many organic compounds, safety and handling precautions are essential, as it may exhibit toxicity or other hazardous properties. Further research is necessary to fully elucidate its biological activity and potential applications in various fields.
Formula:C18H25N3O2
InChI:InChI=1S/C18H25N3O2/c1-18(2,3)23-17(22)21-9-8-19-12-14(21)10-13-11-20-16-7-5-4-6-15(13)16/h4-7,11,14,19-20H,8-10,12H2,1-3H3
InChI key:InChIKey=SZFISJWVBISQGR-UHFFFAOYSA-N
SMILES:C(C=1C=2C(NC1)=CC=CC2)C3N(C(OC(C)(C)C)=O)CCNC3
Synonyms:- 1-Piperazinecarboxylic acid, 2-(1H-indol-3-ylmethyl)-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 2-(1H-indol-3-ylmethyl)-1-piperazinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.