
CAS 1060808-82-3
:4-Bromo-N-methyl-3-pyridinemethanamine
Description:
4-Bromo-N-methyl-3-pyridinemethanamine is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 4-position of the pyridine ring contributes to its reactivity and potential applications in organic synthesis. The N-methyl group indicates that there is a methyl substituent on the nitrogen atom, which can influence the compound's solubility and biological activity. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can affect its interactions in biological systems. Additionally, the presence of the bromine atom may enhance its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. Overall, 4-Bromo-N-methyl-3-pyridinemethanamine is of interest in medicinal chemistry and may serve as a building block for the synthesis of more complex molecules. Its specific applications and behavior would depend on the context of its use in research or industry.
Formula:C7H9BrN2
InChI:InChI=1S/C7H9BrN2/c1-9-4-6-5-10-3-2-7(6)8/h2-3,5,9H,4H2,1H3
InChI key:InChIKey=QNPAQPZFPICIOI-UHFFFAOYSA-N
SMILES:C(NC)C=1C(Br)=CC=NC1
Synonyms:- 3-Pyridinemethanamine, 4-bromo-N-methyl-
- 4-Bromo-N-methyl-3-pyridinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.