CymitQuimica logo

CAS 1060808-97-0

:

1-(4-Chloro-2-pyridinyl)cyclopropanamine

Description:
1-(4-Chloro-2-pyridinyl)cyclopropanamine is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a pyridine moiety substituted with a chlorine atom. This compound features a primary amine functional group, which contributes to its reactivity and potential for forming hydrogen bonds. The presence of the chloro substituent on the pyridine ring can influence the compound's electronic properties, making it a candidate for various chemical reactions and applications in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which may be of interest in drug development. Additionally, the cyclopropane ring introduces strain, which can affect the compound's stability and reactivity. Overall, 1-(4-Chloro-2-pyridinyl)cyclopropanamine is notable for its potential applications in pharmaceuticals, particularly in the development of compounds with specific biological activities. As with any chemical substance, safety and handling precautions should be observed, given its potential biological effects and reactivity.
Formula:C8H9ClN2
InChI:InChI=1S/C8H9ClN2/c9-6-1-4-11-7(5-6)8(10)2-3-8/h1,4-5H,2-3,10H2
InChI key:InChIKey=ZSFRKZNUNCLZIR-UHFFFAOYSA-N
SMILES:NC1(CC1)C2=CC(Cl)=CC=N2
Synonyms:
  • 1-(4-Chloro-2-pyridinyl)cyclopropanamine
  • Cyclopropanamine, 1-(4-chloro-2-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.