
CAS 1060808-98-1
:Cyclopropanamine, 1-(4-chloro-3-pyridinyl)-
Description:
Cyclopropanamine, 1-(4-chloro-3-pyridinyl)- is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a pyridine moiety substituted with a chlorine atom. The presence of the cyclopropane ring contributes to its strain and reactivity, making it an interesting subject for synthetic and medicinal chemistry. The 4-chloro-3-pyridinyl group introduces additional properties, such as potential biological activity, which can be explored in pharmacological contexts. This compound may exhibit various functional properties, including solubility in organic solvents and potential interactions with biological targets due to its nitrogen-containing functional groups. Its molecular structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. As with many nitrogen-containing heterocycles, it may also display interesting pharmacokinetic properties, making it a candidate for further research in drug development. However, specific safety and handling guidelines should be followed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C8H9ClN2
InChI:InChI=1S/C8H9ClN2/c9-7-1-4-11-5-6(7)8(10)2-3-8/h1,4-5H,2-3,10H2
InChI key:InChIKey=YCLPRMUFZMTZKE-UHFFFAOYSA-N
SMILES:NC1(C=2C(Cl)=CC=NC2)CC1
Synonyms:- Cyclopropanamine, 1-(4-chloro-3-pyridinyl)-
- 1-(4-Chloropyridin-3-yl)cyclopropanamine
- 1-(4-Chloropyridin-3-yl)cyclopropan-1-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.