
CAS 1060809-06-4
:4-Chloro-α-(trifluoromethyl)-3-pyridinemethanamine
Description:
4-Chloro-α-(trifluoromethyl)-3-pyridinemethanamine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chloro group and a trifluoromethyl group significantly influences its chemical properties, including its reactivity and polarity. This compound is typically used in pharmaceutical research and development due to its potential biological activity. The trifluoromethyl group enhances lipophilicity, which can improve the compound's ability to penetrate biological membranes. Additionally, the amino group in the structure can participate in hydrogen bonding, making it a potential candidate for interactions with biological targets. Its unique combination of functional groups may also contribute to its stability and solubility in various solvents. As with many halogenated compounds, it is essential to handle this substance with care, considering potential environmental and health impacts. Overall, 4-Chloro-α-(trifluoromethyl)-3-pyridinemethanamine represents a versatile scaffold in medicinal chemistry.
Formula:C7H6ClF3N2
InChI:InChI=1S/C7H6ClF3N2/c8-5-1-2-13-3-4(5)6(12)7(9,10)11/h1-3,6H,12H2
InChI key:InChIKey=PGGYGKSJEXQAQS-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(N)C=1C(Cl)=CC=NC1
Synonyms:- 3-Pyridinemethanamine, 4-chloro-α-(trifluoromethyl)-
- 4-Chloro-α-(trifluoromethyl)-3-pyridinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.