CAS 1060809-10-0

4-Chloro-2-pyridineethanamine

Description:

4-Chloro-2-pyridineethanamine, also known by its CAS number 1060809-10-0, is an organic compound characterized by the presence of a pyridine ring and an amine functional group. This compound features a chloro substituent at the 4-position of the pyridine ring and an ethylamine side chain at the 2-position. Its molecular structure contributes to its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the chlorine atom can influence the compound's reactivity and solubility, while the pyridine ring may enhance its biological activity. Typically, compounds of this nature exhibit moderate polarity, allowing for interactions with various biological targets. Additionally, 4-Chloro-2-pyridineethanamine may participate in hydrogen bonding due to the amine group, which can further affect its pharmacokinetic properties. Safety and handling considerations are essential, as with many amine-containing compounds, due to potential toxicity and reactivity. Overall, this compound represents a valuable structure for further research and development in chemical and pharmaceutical applications.

Formula: C₇H₉ClN₂

InChI: InChI=1S/C7H9ClN2/c8-6-2-4-10-7(5-6)1-3-9/h2,4-5H,1,3,9H2

InChI key: InChIKey=ZIWCQVNBMKXMTF-UHFFFAOYSA-N

SMILES: C(CN)C1=CC(Cl)=CC=N1

Synonyms:

• 2-Pyridineethanamine, 4-chloro-
• 4-Chloro-2-pyridineethanamine