CymitQuimica logo

CAS 1060809-17-7

:

4-Fluoro-3-pyridinemethanamine

Description:
4-Fluoro-3-pyridinemethanamine, with the CAS number 1060809-17-7, is an organic compound characterized by the presence of a pyridine ring substituted with a fluorine atom and an amine group. This compound typically exhibits properties associated with both aromatic and aliphatic amines, including moderate solubility in polar solvents due to the presence of the amine functional group. The fluorine substitution can influence its reactivity and polarity, potentially enhancing its biological activity or interaction with other chemical entities. As a pyridine derivative, it may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it of interest in medicinal chemistry and material science. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. Safety and handling precautions should be observed, as with many amines, due to potential toxicity and reactivity.
Formula:C6H7FN2
InChI:InChI=1S/C6H7FN2/c7-6-1-2-9-4-5(6)3-8/h1-2,4H,3,8H2
InChI key:InChIKey=QCKPTRKQUJYMDJ-UHFFFAOYSA-N
SMILES:C(N)C=1C(F)=CC=NC1
Synonyms:
  • 4-Fluoro-3-pyridinemethanamine
  • 3-Pyridinemethanamine, 4-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.