CAS 1060809-22-4

6-Bromo-4-fluoro-2-pyridinecarboxaldehyde

Description:

6-Bromo-4-fluoro-2-pyridinecarboxaldehyde is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with both bromine and fluorine atoms, as well as an aldehyde functional group. The bromine atom is located at the 6-position, while the fluorine is at the 4-position of the pyridine ring. This compound exhibits typical properties of aldehydes, including reactivity towards nucleophiles and the ability to undergo oxidation to form carboxylic acids. The presence of halogen substituents can influence its reactivity, making it useful in various synthetic applications, particularly in medicinal chemistry and the development of pharmaceuticals. Additionally, the compound's unique structure may impart specific biological activities, making it a subject of interest in drug discovery. Its solubility and stability can vary depending on the solvent and conditions, and it is essential to handle it with care due to potential toxicity associated with halogenated compounds. Overall, 6-Bromo-4-fluoro-2-pyridinecarboxaldehyde is a valuable compound in organic synthesis and research.

Formula: C₆H₃BrFNO

InChI: InChI=1S/C6H3BrFNO/c7-6-2-4(8)1-5(3-10)9-6/h1-3H

InChI key: InChIKey=XDWDJJHTKLARGQ-UHFFFAOYSA-N

SMILES: C(=O)C1=CC(F)=CC(Br)=N1

Synonyms:

• 6-Bromo-4-fluoro-2-pyridinecarboxaldehyde
• 2-Pyridinecarboxaldehyde, 6-bromo-4-fluoro-