
CAS 1060809-49-5
:1-(4-Fluoro-2-pyridinyl)cyclopropanecarboxylic acid
Description:
1-(4-Fluoro-2-pyridinyl)cyclopropanecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a pyridine moiety substituted with a fluorine atom. This compound typically exhibits properties associated with both carboxylic acids and heterocyclic compounds. The presence of the carboxylic acid functional group contributes to its acidity and potential for forming hydrogen bonds, while the fluorine substitution can influence its reactivity and lipophilicity. The pyridine ring may also impart specific electronic properties, making it useful in various chemical reactions and applications, particularly in medicinal chemistry and drug development. Additionally, the compound's structural features may affect its solubility, stability, and interaction with biological targets. Overall, 1-(4-Fluoro-2-pyridinyl)cyclopropanecarboxylic acid represents a versatile scaffold for further chemical modifications and investigations in pharmaceutical research.
Formula:C9H8FNO2
InChI:InChI=1S/C9H8FNO2/c10-6-1-4-11-7(5-6)9(2-3-9)8(12)13/h1,4-5H,2-3H2,(H,12,13)
InChI key:InChIKey=PVXZNFUKLCABSQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(CC1)C2=CC(F)=CC=N2
Synonyms:- Cyclopropanecarboxylic acid, 1-(4-fluoro-2-pyridinyl)-
- 1-(4-Fluoro-2-pyridinyl)cyclopropanecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.