
CAS 1060809-66-6
:4-Amino-6-bromo-2-pyridinecarboxaldehyde
Description:
4-Amino-6-bromo-2-pyridinecarboxaldehyde is a chemical compound characterized by its pyridine ring structure, which includes an amino group and a bromine atom as substituents. This compound features a carboxaldehyde functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the amino group suggests that it can participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions. The bromine atom enhances the compound's electrophilicity, making it useful in coupling reactions or as a precursor for further functionalization. Typically, compounds like this are of interest in medicinal chemistry and materials science due to their potential biological activity and utility in the development of pharmaceuticals. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, 4-Amino-6-bromo-2-pyridinecarboxaldehyde is a versatile building block in synthetic organic chemistry.
Formula:C6H5BrN2O
InChI:InChI=1S/C6H5BrN2O/c7-6-2-4(8)1-5(3-10)9-6/h1-3H,(H2,8,9)
InChI key:InChIKey=OZADDYPNYCELHL-UHFFFAOYSA-N
SMILES:C(=O)C1=CC(N)=CC(Br)=N1
Synonyms:- 2-Pyridinecarboxaldehyde, 4-amino-6-bromo-
- 4-Amino-6-bromo-2-pyridinecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
