CAS 1060809-71-3: 4-Amino-2-bromo-3-pyridinecarboxylic acid
Description:4-Amino-2-bromo-3-pyridinecarboxylic acid is an organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amino group (-NH2) and a bromo substituent (-Br) on the pyridine ring, as well as a carboxylic acid group (-COOH) that contributes to its acidic properties. The presence of these functional groups suggests that it may exhibit both basic and acidic behavior, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The bromine atom introduces a halogen, which can enhance reactivity and influence the compound's physical properties, such as solubility and boiling point. Additionally, the compound may have applications in pharmaceuticals or agrochemicals due to its structural features, which can interact with biological systems. Its specific reactivity and applications would depend on the context of its use and the presence of other functional groups in related compounds.
Formula:C6H5BrN2O2
InChI:InChI=1S/C6H5BrN2O2/c7-5-4(6(10)11)3(8)1-2-9-5/h1-2H,(H2,8,9)(H,10,11)
InChI key:InChIKey=KVJIJXPIWHSDFE-UHFFFAOYSA-N
SMILES:O=C(O)C=1C(Br)=NC=CC1N
- Synonyms:
- 4-Amino-2-bromo-3-pyridinecarboxylic acid
- 3-Pyridinecarboxylic acid, 4-amino-2-bromo-

Ref: 10-F695075
1g | 167.00 € | ||
250mg | 49.00 € |

4-AMino-2-broMo-nicotinic acid
Ref: IN-DA00958V
1g | 115.00 € | ||
5g | 306.00 € | ||
100mg | 42.00 € | ||
250mg | 61.00 € |

4-Amino-2-bromonicotinic Acid
Controlled ProductRef: TR-A602435
5g | 2,320.00 € |

4-Amino-2-bromonicotinic Acid
Ref: 3D-KSB80971
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |