CAS 1060809-98-4
:N-[2-(1H-Indol-3-yl)acetyl]-L-phenylalanine methyl ester
Description:
N-[2-(1H-Indol-3-yl)acetyl]-L-phenylalanine methyl ester, with the CAS number 1060809-98-4, is a synthetic compound that belongs to the class of amino acid derivatives. This substance features an indole moiety, which is a bicyclic structure known for its presence in many biologically active compounds, and is linked to an acetyl group and a phenylalanine residue. The methyl ester functional group enhances its lipophilicity, potentially influencing its biological activity and solubility. The compound may exhibit interesting pharmacological properties, making it a subject of research in medicinal chemistry. Its structural characteristics suggest potential interactions with biological targets, possibly related to neurotransmitter systems or other metabolic pathways. As with many indole derivatives, it may also possess antioxidant or anti-inflammatory properties. However, specific biological activities and mechanisms of action would require further investigation through experimental studies. Overall, this compound represents a fascinating intersection of amino acid chemistry and indole pharmacology.
Formula:C20H20N2O3
InChI:InChI=1S/C20H20N2O3/c1-25-20(24)18(11-14-7-3-2-4-8-14)22-19(23)12-15-13-21-17-10-6-5-9-16(15)17/h2-10,13,18,21H,11-12H2,1H3,(H,22,23)/t18-/m0/s1
InChI key:InChIKey=GEGAFQZCVUOFHP-SFHVURJKSA-N
SMILES:C(C(N[C@@H](CC1=CC=CC=C1)C(OC)=O)=O)C=2C=3C(NC2)=CC=CC3
Synonyms:- N-[2-(1H-Indol-3-yl)acetyl]-L-phenylalanine methyl ester
- L-Phenylalanine, N-[2-(1H-indol-3-yl)acetyl]-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.