CAS 1060810-03-8: 5-Chloro-2-methyl-4-pyridinecarboxylic acid
Description:5-Chloro-2-methyl-4-pyridinecarboxylic acid is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a carboxylic acid functional group (-COOH) and a chlorine atom at the 5-position of the pyridine ring, along with a methyl group at the 2-position. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The chlorine substituent can enhance the compound's biological activity, while the carboxylic acid group can participate in hydrogen bonding and influence solubility in polar solvents. The compound's molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, its synthesis and characterization involve standard organic chemistry techniques, and it may be utilized in the development of novel compounds with specific therapeutic properties. As with many pyridine derivatives, it may exhibit unique properties such as antimicrobial or herbicidal activity, depending on its specific interactions within biological systems.
Formula:C7H6ClNO2
InChI:InChI=1S/C7H6ClNO2/c1-4-2-5(7(10)11)6(8)3-9-4/h2-3H,1H3,(H,10,11)
InChI key:InChIKey=GARAUIFEOTVPAO-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC(=NC=C1Cl)C
- Synonyms:
- 4-Pyridinecarboxylic acid, 5-chloro-2-methyl-
- 5-Chloro-2-methyl-4-pyridinecarboxylic acid
5-Chloro-2-Methylisonicotinic acid
Ref: IN-DA008UB3
| 1g | 262.00 € | ||
| 5g | To inquire | ||
| 100mg | 105.00 € | ||
| 250mg | 178.00 € |
5-Chloro-2-methylisonicotinic acid
Ref: 10-F320979
| 1g | 393.00 € | ||
| 5g | 1,439.00 € | ||
| 100mg | 120.00 € | ||
| 250mg | 211.00 € |
5-Chloro-2-methylisonicotinic acid
Ref: 3D-KSB81003
| 250mg | 400.00 € | ||
| 2500mg | 1,190.00 € |
