CAS 1060810-16-3

5-Bromo-2-methyl-4-pyridinecarboxylic acid

Description:

5-Bromo-2-methyl-4-pyridinecarboxylic acid is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with a bromine atom, a methyl group, and a carboxylic acid functional group. The bromine substitution typically enhances the compound's reactivity and can influence its biological activity. The methyl group contributes to the compound's hydrophobic characteristics, while the carboxylic acid group imparts acidic properties, allowing for potential interactions in various chemical environments. This compound is often utilized in pharmaceutical and agrochemical research due to its potential as a building block in the synthesis of more complex molecules. Its solubility in polar solvents is influenced by the carboxylic acid group, making it amenable to various chemical reactions, including esterification and amidation. Additionally, the presence of the pyridine ring may contribute to its ability to act as a ligand in coordination chemistry. Overall, 5-Bromo-2-methyl-4-pyridinecarboxylic acid is a versatile compound with applications in synthetic organic chemistry and medicinal chemistry.

Formula: C₇H₆BrNO₂

InChI: InChI=1S/C7H6BrNO2/c1-4-2-5(7(10)11)6(8)3-9-4/h2-3H,1H3,(H,10,11)

InChI key: InChIKey=YLVYBBYAJDRTGE-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(Br)=CN=C(C)C1

Synonyms:

• 5-Bromo-2-methylisonicotinic acid
• 5-Bromo-2-methyl-4-pyridinecarboxylic acid
• 4-Pyridinecarboxylic acid, 5-bromo-2-methyl-